C18H16ClN3O2 — CID 2088419
4-chloro-N'-[3-(1H-indol-3-yl)propanoyl]benzohydrazide (PubChem CID 2088419) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is 4-chloro-N'-[3-(1H-indol-3-yl)propanoyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[3-(1H-indol-3-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 2088419 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 4-chloro-N'-[3-(1H-indol-3-yl)propanoyl]benzohydrazide |
| SMILES | O=C(CCc1c[nH]c2ccccc12)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3O2/c19-14-8-5-12(6-9-14)18(24)22-21-17(23)10-7-13-11-20-16-4-2-1-3-15(13)16/h1-6,8-9,11,20H,7,10H2,(H,21,23)(H,22,24) |
| InChIKey | RYYJZSWOFMKSTC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|