C19H17Cl2N3O2 — CID 35681432
3-(2,4-dichlorophenyl)-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide (PubChem CID 35681432) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide.
| Compound Name | 3-(2,4-dichlorophenyl)-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 35681432 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)NNC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17Cl2N3O2/c20-14-7-5-12(16(21)10-14)6-8-18(25)23-24-19(26)9-13-11-22-17-4-2-1-3-15(13)17/h1-5,7,10-11,22H,6,8-9H2,(H,23,25)(H,24,26) |
| InChIKey | ZNAMBUHVSWQFAO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|