C17H14ClFN4OS — CID 8767861
1-(3-chloro-4-fluorophenyl)-3-[[2-(1H-indol-3-yl)acetyl]amino]thiourea (PubChem CID 8767861) has the molecular formula C17H14ClFN4OS and a molecular weight of 376.84 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[[2-(1H-indol-3-yl)acetyl]amino]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[[2-(1H-indol-3-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8767861 |
| Molecular Formula | C17H14ClFN4OS |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[[2-(1H-indol-3-yl)acetyl]amino]thiourea |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NNC(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H14ClFN4OS/c18-13-8-11(5-6-14(13)19)21-17(25)23-22-16(24)7-10-9-20-15-4-2-1-3-12(10)15/h1-6,8-9,20H,7H2,(H,22,24)(H2,21,23,25) |
| InChIKey | PCGARTQTZXOGCX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|