C12H16ClFN4OS — CID 8786836
1-(3-chloro-4-fluorophenyl)-3-[3-(dimethylamino)propanoylamino]thiourea (PubChem CID 8786836) has the molecular formula C12H16ClFN4OS and a molecular weight of 318.81 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[3-(dimethylamino)propanoylamino]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[3-(dimethylamino)propanoylamino]thiourea |
|---|---|
| PubChem CID | 8786836 |
| Molecular Formula | C12H16ClFN4OS |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[3-(dimethylamino)propanoylamino]thiourea |
| SMILES | CN(C)CCC(=O)NNC(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClFN4OS/c1-18(2)6-5-11(19)16-17-12(20)15-8-3-4-10(14)9(13)7-8/h3-4,7H,5-6H2,1-2H3,(H,16,19)(H2,15,17,20) |
| InChIKey | QROGBHCJRSBQCB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|