C8H7ClFN3OS — CID 17370916
N-[(3-chloro-4-fluorophenyl)carbamothioylamino]formamide (PubChem CID 17370916) has the molecular formula C8H7ClFN3OS and a molecular weight of 247.68 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)carbamothioylamino]formamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)carbamothioylamino]formamide |
|---|---|
| PubChem CID | 17370916 |
| Molecular Formula | C8H7ClFN3OS |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)carbamothioylamino]formamide |
| SMILES | O=CNNC(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C8H7ClFN3OS/c9-6-3-5(1-2-7(6)10)12-8(15)13-11-4-14/h1-4H,(H,11,14)(H2,12,13,15) |
| InChIKey | QPLLWXPPAOITLM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|