C15H15ClFN3S — CID 8668793
1-(3-chloro-4-fluorophenyl)-3-(2,4-dimethylanilino)thiourea (PubChem CID 8668793) has the molecular formula C15H15ClFN3S and a molecular weight of 323.82 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(2,4-dimethylanilino)thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-(2,4-dimethylanilino)thiourea |
|---|---|
| PubChem CID | 8668793 |
| Molecular Formula | C15H15ClFN3S |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(2,4-dimethylanilino)thiourea |
| SMILES | Cc1ccc(NNC(=S)Nc2ccc(F)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C15H15ClFN3S/c1-9-3-6-14(10(2)7-9)19-20-15(21)18-11-4-5-13(17)12(16)8-11/h3-8,19H,1-2H3,(H2,18,20,21) |
| InChIKey | ZPZGXYLPXWFVDQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|