C16H16ClFN4OS — CID 8617704
1-(3-chloro-4-fluorophenyl)-3-[[2-(4-methylanilino)acetyl]amino]thiourea (PubChem CID 8617704) has the molecular formula C16H16ClFN4OS and a molecular weight of 366.85 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[[2-(4-methylanilino)acetyl]amino]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[[2-(4-methylanilino)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8617704 |
| Molecular Formula | C16H16ClFN4OS |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[[2-(4-methylanilino)acetyl]amino]thiourea |
| SMILES | Cc1ccc(NCC(=O)NNC(=S)Nc2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H16ClFN4OS/c1-10-2-4-11(5-3-10)19-9-15(23)21-22-16(24)20-12-6-7-14(18)13(17)8-12/h2-8,19H,9H2,1H3,(H,21,23)(H2,20,22,24) |
| InChIKey | SLVAJAYAIYHBSX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|