C17H18ClFN2O3 — CID 54822297
N-(3-chloro-4-fluorophenyl)-2-[4-(2-methoxyethoxy)anilino]acetamide (PubChem CID 54822297) has the molecular formula C17H18ClFN2O3 and a molecular weight of 352.79 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[4-(2-methoxyethoxy)anilino]acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[4-(2-methoxyethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54822297 |
| Molecular Formula | C17H18ClFN2O3 |
| Molecular Weight | 352.79 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[4-(2-methoxyethoxy)anilino]acetamide |
| SMILES | COCCOc1ccc(NCC(=O)Nc2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H18ClFN2O3/c1-23-8-9-24-14-5-2-12(3-6-14)20-11-17(22)21-13-4-7-16(19)15(18)10-13/h2-7,10,20H,8-9,11H2,1H3,(H,21,22) |
| InChIKey | JTLGSSIFRYVEBV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|