C21H28N2O4 — CID 54822490
2-[4-(2-methoxyethoxy)anilino]-N-[4-(2-methylpropoxy)phenyl]acetamide (PubChem CID 54822490) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[4-(2-methoxyethoxy)anilino]-N-[4-(2-methylpropoxy)phenyl]acetamide.
| Compound Name | 2-[4-(2-methoxyethoxy)anilino]-N-[4-(2-methylpropoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54822490 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-[4-(2-methoxyethoxy)anilino]-N-[4-(2-methylpropoxy)phenyl]acetamide |
| SMILES | COCCOc1ccc(NCC(=O)Nc2ccc(OCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H28N2O4/c1-16(2)15-27-20-10-6-18(7-11-20)23-21(24)14-22-17-4-8-19(9-5-17)26-13-12-25-3/h4-11,16,22H,12-15H2,1-3H3,(H,23,24) |
| InChIKey | WZMQRVBRILQJNM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|