C22H30N2O3 — CID 54824959
2-(3-butoxyanilino)-N-[4-(2-methylpropoxy)phenyl]acetamide (PubChem CID 54824959) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-(3-butoxyanilino)-N-[4-(2-methylpropoxy)phenyl]acetamide.
| Compound Name | 2-(3-butoxyanilino)-N-[4-(2-methylpropoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54824959 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 2-(3-butoxyanilino)-N-[4-(2-methylpropoxy)phenyl]acetamide |
| SMILES | CCCCOc1cccc(NCC(=O)Nc2ccc(OCC(C)C)cc2)c1 |
| InChI | InChI=1S/C22H30N2O3/c1-4-5-13-26-21-8-6-7-19(14-21)23-15-22(25)24-18-9-11-20(12-10-18)27-16-17(2)3/h6-12,14,17,23H,4-5,13,15-16H2,1-3H3,(H,24,25) |
| InChIKey | VPNXKDTZMZDLAZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|