C22H29ClN2O3 — CID 54822051
N-(3-chloro-4-methoxyphenyl)-2-(4-heptoxyanilino)acetamide (PubChem CID 54822051) has the molecular formula C22H29ClN2O3 and a molecular weight of 404.94 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-(4-heptoxyanilino)acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-(4-heptoxyanilino)acetamide |
|---|---|
| PubChem CID | 54822051 |
| Molecular Formula | C22H29ClN2O3 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-(4-heptoxyanilino)acetamide |
| SMILES | CCCCCCCOc1ccc(NCC(=O)Nc2ccc(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H29ClN2O3/c1-3-4-5-6-7-14-28-19-11-8-17(9-12-19)24-16-22(26)25-18-10-13-21(27-2)20(23)15-18/h8-13,15,24H,3-7,14,16H2,1-2H3,(H,25,26) |
| InChIKey | BPQWVXISTHMWKI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|