C18H20Cl2N2O3 — CID 54825678
N-(3,5-dichlorophenyl)-2-[4-(2-ethoxyethoxy)anilino]acetamide (PubChem CID 54825678) has the molecular formula C18H20Cl2N2O3 and a molecular weight of 383.28 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[4-(2-ethoxyethoxy)anilino]acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[4-(2-ethoxyethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54825678 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[4-(2-ethoxyethoxy)anilino]acetamide |
| SMILES | CCOCCOc1ccc(NCC(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H20Cl2N2O3/c1-2-24-7-8-25-17-5-3-15(4-6-17)21-12-18(23)22-16-10-13(19)9-14(20)11-16/h3-6,9-11,21H,2,7-8,12H2,1H3,(H,22,23) |
| InChIKey | NXPZDCQYNRTZIL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|