C19H22Cl2N2O2 — CID 54821699
N-(3,5-dichlorophenyl)-2-[4-(3-methylbutoxy)anilino]acetamide (PubChem CID 54821699) has the molecular formula C19H22Cl2N2O2 and a molecular weight of 381.30 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[4-(3-methylbutoxy)anilino]acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[4-(3-methylbutoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54821699 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[4-(3-methylbutoxy)anilino]acetamide |
| SMILES | CC(C)CCOc1ccc(NCC(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H22Cl2N2O2/c1-13(2)7-8-25-18-5-3-16(4-6-18)22-12-19(24)23-17-10-14(20)9-15(21)11-17/h3-6,9-11,13,22H,7-8,12H2,1-2H3,(H,23,24) |
| InChIKey | HZCRAASKGUTSSH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|