C21H28N2O2 — CID 54813449
2-(3,5-dimethylanilino)-N-[4-(3-methylbutoxy)phenyl]acetamide (PubChem CID 54813449) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-(3,5-dimethylanilino)-N-[4-(3-methylbutoxy)phenyl]acetamide.
| Compound Name | 2-(3,5-dimethylanilino)-N-[4-(3-methylbutoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54813449 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2-(3,5-dimethylanilino)-N-[4-(3-methylbutoxy)phenyl]acetamide |
| SMILES | Cc1cc(C)cc(NCC(=O)Nc2ccc(OCCC(C)C)cc2)c1 |
| InChI | InChI=1S/C21H28N2O2/c1-15(2)9-10-25-20-7-5-18(6-8-20)23-21(24)14-22-19-12-16(3)11-17(4)13-19/h5-8,11-13,15,22H,9-10,14H2,1-4H3,(H,23,24) |
| InChIKey | DEHILLCEFGMHAN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |