C19H23BrN2O2 — CID 24832146
2-bromo-N-[4-[4-(3-methylbutoxy)anilino]phenyl]acetamide (PubChem CID 24832146) has the molecular formula C19H23BrN2O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 2-bromo-N-[4-[4-(3-methylbutoxy)anilino]phenyl]acetamide.
| Compound Name | 2-bromo-N-[4-[4-(3-methylbutoxy)anilino]phenyl]acetamide |
|---|---|
| PubChem CID | 24832146 |
| Molecular Formula | C19H23BrN2O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-bromo-N-[4-[4-(3-methylbutoxy)anilino]phenyl]acetamide |
| SMILES | CC(C)CCOc1ccc(Nc2ccc(NC(=O)CBr)cc2)cc1 |
| InChI | InChI=1S/C19H23BrN2O2/c1-14(2)11-12-24-18-9-7-16(8-10-18)21-15-3-5-17(6-4-15)22-19(23)13-20/h3-10,14,21H,11-13H2,1-2H3,(H,22,23) |
| InChIKey | SDXOOGJZVZFFGH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|