C15H16ClN3S — CID 8668782
1-(4-chlorophenyl)-3-(2,4-dimethylanilino)thiourea (PubChem CID 8668782) has the molecular formula C15H16ClN3S and a molecular weight of 305.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2,4-dimethylanilino)thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-(2,4-dimethylanilino)thiourea |
|---|---|
| PubChem CID | 8668782 |
| Molecular Formula | C15H16ClN3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2,4-dimethylanilino)thiourea |
| SMILES | Cc1ccc(NNC(=S)Nc2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C15H16ClN3S/c1-10-3-8-14(11(2)9-10)18-19-15(20)17-13-6-4-12(16)5-7-13/h3-9,18H,1-2H3,(H2,17,19,20) |
| InChIKey | ARAFCVWDRJRJDN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|