C15H15ClN4OS — CID 832889
1-(4-chlorophenyl)-3-[(4-methylphenyl)carbamothioylamino]urea (PubChem CID 832889) has the molecular formula C15H15ClN4OS and a molecular weight of 334.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(4-methylphenyl)carbamothioylamino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(4-methylphenyl)carbamothioylamino]urea |
|---|---|
| PubChem CID | 832889 |
| Molecular Formula | C15H15ClN4OS |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(4-methylphenyl)carbamothioylamino]urea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H15ClN4OS/c1-10-2-6-13(7-3-10)18-15(22)20-19-14(21)17-12-8-4-11(16)5-9-12/h2-9H,1H3,(H2,17,19,21)(H2,18,20,22) |
| InChIKey | JLRHYIUALGZJOP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|