C15H16N6OS2 — CID 102154024
1-phenyl-3-[(phenylcarbamothioylamino)carbamothioylamino]urea (PubChem CID 102154024) has the molecular formula C15H16N6OS2 and a molecular weight of 360.47 g/mol. Its IUPAC name is 1-phenyl-3-[(phenylcarbamothioylamino)carbamothioylamino]urea.
| Compound Name | 1-phenyl-3-[(phenylcarbamothioylamino)carbamothioylamino]urea |
|---|---|
| PubChem CID | 102154024 |
| Molecular Formula | C15H16N6OS2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 1-phenyl-3-[(phenylcarbamothioylamino)carbamothioylamino]urea |
| SMILES | O=C(NNC(=S)NNC(=S)Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C15H16N6OS2/c22-13(16-11-7-3-1-4-8-11)18-20-15(24)21-19-14(23)17-12-9-5-2-6-10-12/h1-10H,(H2,16,18,22)(H2,17,19,23)(H2,20,21,24) |
| InChIKey | OCICQNNHVPNCGI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|