C18H20N6O4S2 — CID 7096739
1-[[(2R,3R)-2,3-dihydroxy-4-oxo-4-[2-(phenylcarbamothioyl)hydrazinyl]butanoyl]amino]-3-phenylthiourea (PubChem CID 7096739) has the molecular formula C18H20N6O4S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-[[(2R,3R)-2,3-dihydroxy-4-oxo-4-[2-(phenylcarbamothioyl)hydrazinyl]butanoyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[(2R,3R)-2,3-dihydroxy-4-oxo-4-[2-(phenylcarbamothioyl)hydrazinyl]butanoyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 7096739 |
| Molecular Formula | C18H20N6O4S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 1-[[(2R,3R)-2,3-dihydroxy-4-oxo-4-[2-(phenylcarbamothioyl)hydrazinyl]butanoyl]amino]-3-phenylthiourea |
| SMILES | O=C(NNC(=S)Nc1ccccc1)[C@H](O)[C@@H](O)C(=O)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C18H20N6O4S2/c25-13(15(27)21-23-17(29)19-11-7-3-1-4-8-11)14(26)16(28)22-24-18(30)20-12-9-5-2-6-10-12/h1-10,13-14,25-26H,(H,21,27)(H,22,28)(H2,19,23,29)(H2,20,24,30)/t13-,14-/m1/s1 |
| InChIKey | YGOKVUDSZOZCBB-ZIAGYGMSSA-N |
| XLogP | -0.26 |
| TPSA | 146.78 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|