C18H20N4O2S — CID 1263273
2-methyl-N-[4-[(phenylcarbamothioylamino)carbamoyl]phenyl]propanamide (PubChem CID 1263273) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-methyl-N-[4-[(phenylcarbamothioylamino)carbamoyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[(phenylcarbamothioylamino)carbamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 1263273 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-methyl-N-[4-[(phenylcarbamothioylamino)carbamoyl]phenyl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)NNC(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C18H20N4O2S/c1-12(2)16(23)19-15-10-8-13(9-11-15)17(24)21-22-18(25)20-14-6-4-3-5-7-14/h3-12H,1-2H3,(H,19,23)(H,21,24)(H2,20,22,25) |
| InChIKey | CHTGKQPAVCNUNG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|