C28H32N6O10S2 — CID 10258993
[(2S,3R,4S,5R)-2,4,5-triacetyloxy-1,6-dioxo-1,6-bis[2-(phenylcarbamothioyl)hydrazinyl]hexan-3-yl] acetate (PubChem CID 10258993) has the molecular formula C28H32N6O10S2 and a molecular weight of 676.73 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-2,4,5-triacetyloxy-1,6-dioxo-1,6-bis[2-(phenylcarbamothioyl)hydrazinyl]hexan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5R)-2,4,5-triacetyloxy-1,6-dioxo-1,6-bis[2-(phenylcarbamothioyl)hydrazinyl]hexan-3-yl] acetate |
|---|---|
| PubChem CID | 10258993 |
| Molecular Formula | C28H32N6O10S2 |
| Molecular Weight | 676.73 g/mol |
| Exact Mass | 676.16 |
| IUPAC Name | [(2S,3R,4S,5R)-2,4,5-triacetyloxy-1,6-dioxo-1,6-bis[2-(phenylcarbamothioyl)hydrazinyl]hexan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]([C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)NNC(=S)Nc1ccccc1)[C@H](OC(C)=O)C(=O)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C28H32N6O10S2/c1-15(35)41-21(23(43-17(3)37)25(39)31-33-27(45)29-19-11-7-5-8-12-19)22(42-16(2)36)24(44-18(4)38)26(40)32-34-28(46)30-20-13-9-6-10-14-20/h5-14,21-24H,1-4H3,(H,31,39)(H,32,40)(H2,29,33,45)(H2,30,34,46)/t21-,22+,23+,24- |
| InChIKey | JXNMQHXMXLYHMR-NVPYSNMXSA-N |
| XLogP | 0.75 |
| TPSA | 211.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.73 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|