C28H32N2O12 — CID 4863606
[2,4,5-triacetyloxy-1,6-bis(2-methoxyanilino)-1,6-dioxohexan-3-yl] acetate (PubChem CID 4863606) has the molecular formula C28H32N2O12 and a molecular weight of 588.57 g/mol. Its IUPAC name is [2,4,5-triacetyloxy-1,6-bis(2-methoxyanilino)-1,6-dioxohexan-3-yl] acetate.
| Compound Name | [2,4,5-triacetyloxy-1,6-bis(2-methoxyanilino)-1,6-dioxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 4863606 |
| Molecular Formula | C28H32N2O12 |
| Molecular Weight | 588.57 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | [2,4,5-triacetyloxy-1,6-bis(2-methoxyanilino)-1,6-dioxohexan-3-yl] acetate |
| SMILES | COc1ccccc1NC(=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C28H32N2O12/c1-15(31)39-23(25(41-17(3)33)27(35)29-19-11-7-9-13-21(19)37-5)24(40-16(2)32)26(42-18(4)34)28(36)30-20-12-8-10-14-22(20)38-6/h7-14,23-26H,1-6H3,(H,29,35)(H,30,36) |
| InChIKey | OFZQPIRAZQTNLC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.57 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|