C11H9BrF3NO3 — CID 129452961
(2R)-2-bromo-4,4,4-trifluoro-N-(2-methoxyphenyl)-3-oxobutanamide (PubChem CID 129452961) has the molecular formula C11H9BrF3NO3 and a molecular weight of 340.10 g/mol. Its IUPAC name is (2R)-2-bromo-4,4,4-trifluoro-N-(2-methoxyphenyl)-3-oxobutanamide.
| Compound Name | (2R)-2-bromo-4,4,4-trifluoro-N-(2-methoxyphenyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 129452961 |
| Molecular Formula | C11H9BrF3NO3 |
| Molecular Weight | 340.10 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | (2R)-2-bromo-4,4,4-trifluoro-N-(2-methoxyphenyl)-3-oxobutanamide |
| SMILES | COc1ccccc1NC(=O)[C@H](Br)C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H9BrF3NO3/c1-19-7-5-3-2-4-6(7)16-10(18)8(12)9(17)11(13,14)15/h2-5,8H,1H3,(H,16,18)/t8-/m1/s1 |
| InChIKey | HLZBUAGHKCIIKD-MRVPVSSYSA-N |
| XLogP | 2.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.10 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|