C14H15N4OS+ — CID 3864523
1-phenyl-3-[(2-pyridin-1-ium-1-ylacetyl)amino]thiourea (PubChem CID 3864523) has the molecular formula C14H15N4OS+ and a molecular weight of 287.37 g/mol. Its IUPAC name is 1-phenyl-3-[(2-pyridin-1-ium-1-ylacetyl)amino]thiourea.
| Compound Name | 1-phenyl-3-[(2-pyridin-1-ium-1-ylacetyl)amino]thiourea |
|---|---|
| PubChem CID | 3864523 |
| Molecular Formula | C14H15N4OS+ |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-phenyl-3-[(2-pyridin-1-ium-1-ylacetyl)amino]thiourea |
| SMILES | O=C(C[n+]1ccccc1)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C14H14N4OS/c19-13(11-18-9-5-2-6-10-18)16-17-14(20)15-12-7-3-1-4-8-12/h1-10H,11H2,(H2-,15,16,17,19,20)/p+1 |
| InChIKey | VVHSTIRLKOWPLJ-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 57.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|