C16H25N3OS — CID 86107669
1-(4-methylphenyl)-3-(octanoylamino)thiourea (PubChem CID 86107669) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(octanoylamino)thiourea.
| Compound Name | 1-(4-methylphenyl)-3-(octanoylamino)thiourea |
|---|---|
| PubChem CID | 86107669 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-(4-methylphenyl)-3-(octanoylamino)thiourea |
| SMILES | CCCCCCCC(=O)NNC(=S)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C16H25N3OS/c1-3-4-5-6-7-8-15(20)18-19-16(21)17-14-11-9-13(2)10-12-14/h9-12H,3-8H2,1-2H3,(H,18,20)(H2,17,19,21) |
| InChIKey | WRQBLPUMIAMCQF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|