C25H36N6O2S — CID 152746094
1,3-bis[4-(2-hexanoylhydrazinyl)phenyl]thiourea (PubChem CID 152746094) has the molecular formula C25H36N6O2S and a molecular weight of 484.67 g/mol. Its IUPAC name is 1,3-bis[4-(2-hexanoylhydrazinyl)phenyl]thiourea.
| Compound Name | 1,3-bis[4-(2-hexanoylhydrazinyl)phenyl]thiourea |
|---|---|
| PubChem CID | 152746094 |
| Molecular Formula | C25H36N6O2S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 1,3-bis[4-(2-hexanoylhydrazinyl)phenyl]thiourea |
| SMILES | CCCCCC(=O)NNc1ccc(NC(=S)Nc2ccc(NNC(=O)CCCCC)cc2)cc1 |
| InChI | InChI=1S/C25H36N6O2S/c1-3-5-7-9-23(32)30-28-21-15-11-19(12-16-21)26-25(34)27-20-13-17-22(18-14-20)29-31-24(33)10-8-6-4-2/h11-18,28-29H,3-10H2,1-2H3,(H,30,32)(H,31,33)(H2,26,27,34) |
| InChIKey | SLEWHFNVJNASHI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|