C15H15ClN2O — CID 2982210
1-[(4-chlorophenyl)methyl]-3-(4-methylphenyl)urea (PubChem CID 2982210) has the molecular formula C15H15ClN2O and a molecular weight of 274.75 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 2982210 |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H15ClN2O/c1-11-2-8-14(9-3-11)18-15(19)17-10-12-4-6-13(16)7-5-12/h2-9H,10H2,1H3,(H2,17,18,19) |
| InChIKey | PDPJJAAPBLSLST-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |