C15H17Cl2N3O — CID 166173336
1-[4-(aminomethyl)phenyl]-3-[(4-chlorophenyl)methyl]urea;hydrochloride (PubChem CID 166173336) has the molecular formula C15H17Cl2N3O and a molecular weight of 326.23 g/mol. Its IUPAC name is 1-[4-(aminomethyl)phenyl]-3-[(4-chlorophenyl)methyl]urea;hydrochloride.
| Compound Name | 1-[4-(aminomethyl)phenyl]-3-[(4-chlorophenyl)methyl]urea;hydrochloride |
|---|---|
| PubChem CID | 166173336 |
| Molecular Formula | C15H17Cl2N3O |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 1-[4-(aminomethyl)phenyl]-3-[(4-chlorophenyl)methyl]urea;hydrochloride |
| SMILES | Cl.NCc1ccc(NC(=O)NCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H16ClN3O.ClH/c16-13-5-1-12(2-6-13)10-18-15(20)19-14-7-3-11(9-17)4-8-14;/h1-8H,9-10,17H2,(H2,18,19,20);1H |
| InChIKey | CVNXFRBRHVANKV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |