C15H16N2O4S — CID 108899031
4-[(4-methylphenyl)methylcarbamoylamino]benzenesulfonic acid (PubChem CID 108899031) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 4-[(4-methylphenyl)methylcarbamoylamino]benzenesulfonic acid.
| Compound Name | 4-[(4-methylphenyl)methylcarbamoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108899031 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-[(4-methylphenyl)methylcarbamoylamino]benzenesulfonic acid |
| SMILES | Cc1ccc(CNC(=O)Nc2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C15H16N2O4S/c1-11-2-4-12(5-3-11)10-16-15(18)17-13-6-8-14(9-7-13)22(19,20)21/h2-9H,10H2,1H3,(H2,16,17,18)(H,19,20,21) |
| InChIKey | DMUSFKXXVYTBMP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|