C17H20N2O3S — CID 47033074
1-(2-methyl-5-methylsulfonylphenyl)-3-[(4-methylphenyl)methyl]urea (PubChem CID 47033074) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-(2-methyl-5-methylsulfonylphenyl)-3-[(4-methylphenyl)methyl]urea.
| Compound Name | 1-(2-methyl-5-methylsulfonylphenyl)-3-[(4-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 47033074 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-(2-methyl-5-methylsulfonylphenyl)-3-[(4-methylphenyl)methyl]urea |
| SMILES | Cc1ccc(CNC(=O)Nc2cc(S(C)(=O)=O)ccc2C)cc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-12-4-7-14(8-5-12)11-18-17(20)19-16-10-15(23(3,21)22)9-6-13(16)2/h4-10H,11H2,1-3H3,(H2,18,19,20) |
| InChIKey | KTBVYVNHJOVYEQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |