C10H14N4S2 — CID 8001100
1-methyl-3-[(4-methylphenyl)carbamothioylamino]thiourea (PubChem CID 8001100) has the molecular formula C10H14N4S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 1-methyl-3-[(4-methylphenyl)carbamothioylamino]thiourea.
| Compound Name | 1-methyl-3-[(4-methylphenyl)carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 8001100 |
| Molecular Formula | C10H14N4S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-methyl-3-[(4-methylphenyl)carbamothioylamino]thiourea |
| SMILES | CNC(=S)NNC(=S)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C10H14N4S2/c1-7-3-5-8(6-4-7)12-10(16)14-13-9(15)11-2/h3-6H,1-2H3,(H2,11,13,15)(H2,12,14,16) |
| InChIKey | QEOIANZKDYSIPY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|