C12H14N2S — CID 166736589
1-(cyclodecapentaenyl)-3-methylthiourea (PubChem CID 166736589) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 1-(cyclodecapentaenyl)-3-methylthiourea.
| Compound Name | 1-(cyclodecapentaenyl)-3-methylthiourea |
|---|---|
| PubChem CID | 166736589 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1-(cyclodecapentaenyl)-3-methylthiourea |
| SMILES | CNC(=S)Nc1ccccccccc1 |
| InChI | InChI=1S/C12H14N2S/c1-13-12(15)14-11-9-7-5-3-2-4-6-8-10-11/h2-10H,1H3,(H2,13,14,15)/b3-2-,4-2-,5-3-,6-4+,7-5+,8-6+,9-7+,10-8-,11-9+,11-10+ |
| InChIKey | FBTULCUGJWUYOE-WHPVTRNFSA-N |
| XLogP | 2.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|