C15H16N2S — CID 837227
1-(3,4-dimethylphenyl)-3-phenylthiourea (PubChem CID 837227) has the molecular formula C15H16N2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-phenylthiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-phenylthiourea |
|---|---|
| PubChem CID | 837227 |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-phenylthiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccccc2)cc1C |
| InChI | InChI=1S/C15H16N2S/c1-11-8-9-14(10-12(11)2)17-15(18)16-13-6-4-3-5-7-13/h3-10H,1-2H3,(H2,16,17,18) |
| InChIKey | RKTUVGHHHQZGDT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|