C19H18N2OS — CID 23960305
1-(3,4-dimethylphenyl)-3-(5-hydroxynaphthalen-1-yl)thiourea (PubChem CID 23960305) has the molecular formula C19H18N2OS and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(5-hydroxynaphthalen-1-yl)thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-(5-hydroxynaphthalen-1-yl)thiourea |
|---|---|
| PubChem CID | 23960305 |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(5-hydroxynaphthalen-1-yl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2cccc3c(O)cccc23)cc1C |
| InChI | InChI=1S/C19H18N2OS/c1-12-9-10-14(11-13(12)2)20-19(23)21-17-7-3-6-16-15(17)5-4-8-18(16)22/h3-11,22H,1-2H3,(H2,20,21,23) |
| InChIKey | VMCWFYIAJCZYKA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|