C18H17N3S — CID 2361774
1-(3,4-dimethylphenyl)-3-isoquinolin-5-ylthiourea (PubChem CID 2361774) has the molecular formula C18H17N3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-isoquinolin-5-ylthiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-isoquinolin-5-ylthiourea |
|---|---|
| PubChem CID | 2361774 |
| Molecular Formula | C18H17N3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-isoquinolin-5-ylthiourea |
| SMILES | Cc1ccc(NC(=S)Nc2cccc3cnccc23)cc1C |
| InChI | InChI=1S/C18H17N3S/c1-12-6-7-15(10-13(12)2)20-18(22)21-17-5-3-4-14-11-19-9-8-16(14)17/h3-11H,1-2H3,(H2,20,21,22) |
| InChIKey | QMQXKMRAOKKVLD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|