C22H24N4O — CID 10067089
4-(3,4-dimethylphenyl)-N-isoquinolin-5-ylpiperazine-1-carboxamide (PubChem CID 10067089) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-N-isoquinolin-5-ylpiperazine-1-carboxamide.
| Compound Name | 4-(3,4-dimethylphenyl)-N-isoquinolin-5-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 10067089 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-N-isoquinolin-5-ylpiperazine-1-carboxamide |
| SMILES | Cc1ccc(N2CCN(C(=O)Nc3cccc4cnccc34)CC2)cc1C |
| InChI | InChI=1S/C22H24N4O/c1-16-6-7-19(14-17(16)2)25-10-12-26(13-11-25)22(27)24-21-5-3-4-18-15-23-9-8-20(18)21/h3-9,14-15H,10-13H2,1-2H3,(H,24,27) |
| InChIKey | SUVPKIXCVJJGMS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|