C19H22N6O — CID 72885121
4-(2,6-dimethyl-4-pyridinyl)-N-(1H-indazol-7-yl)piperazine-1-carboxamide (PubChem CID 72885121) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 4-(2,6-dimethyl-4-pyridinyl)-N-(1H-indazol-7-yl)piperazine-1-carboxamide.
| Compound Name | 4-(2,6-dimethyl-4-pyridinyl)-N-(1H-indazol-7-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 72885121 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 4-(2,6-dimethyl-4-pyridinyl)-N-(1H-indazol-7-yl)piperazine-1-carboxamide |
| SMILES | Cc1cc(N2CCN(C(=O)Nc3cccc4cn[nH]c34)CC2)cc(C)n1 |
| InChI | InChI=1S/C19H22N6O/c1-13-10-16(11-14(2)21-13)24-6-8-25(9-7-24)19(26)22-17-5-3-4-15-12-20-23-18(15)17/h3-5,10-12H,6-9H2,1-2H3,(H,20,23)(H,22,26) |
| InChIKey | VGLIBEQPSTZAFL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |