C15H15Cl2N3S — CID 27000952
1-(4-amino-3,5-dichlorophenyl)-3-(3,4-dimethylphenyl)thiourea (PubChem CID 27000952) has the molecular formula C15H15Cl2N3S and a molecular weight of 340.28 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 27000952 |
| Molecular Formula | C15H15Cl2N3S |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-3-(3,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2cc(Cl)c(N)c(Cl)c2)cc1C |
| InChI | InChI=1S/C15H15Cl2N3S/c1-8-3-4-10(5-9(8)2)19-15(21)20-11-6-12(16)14(18)13(17)7-11/h3-7H,18H2,1-2H3,(H2,19,20,21) |
| InChIKey | SHKZAYLEKVZNKD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|