C14H10Cl4N2S — CID 4150337
1-(2,6-dichloro-3-methylphenyl)-3-(3,4-dichlorophenyl)thiourea (PubChem CID 4150337) has the molecular formula C14H10Cl4N2S and a molecular weight of 380.13 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-methylphenyl)-3-(3,4-dichlorophenyl)thiourea.
| Compound Name | 1-(2,6-dichloro-3-methylphenyl)-3-(3,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 4150337 |
| Molecular Formula | C14H10Cl4N2S |
| Molecular Weight | 380.13 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 1-(2,6-dichloro-3-methylphenyl)-3-(3,4-dichlorophenyl)thiourea |
| SMILES | Cc1ccc(Cl)c(NC(=S)Nc2ccc(Cl)c(Cl)c2)c1Cl |
| InChI | InChI=1S/C14H10Cl4N2S/c1-7-2-4-10(16)13(12(7)18)20-14(21)19-8-3-5-9(15)11(17)6-8/h2-6H,1H3,(H2,19,20,21) |
| InChIKey | OYCGKMUAHQETHE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.13 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|