C9H11Cl2N3S — CID 8625286
1-(4-amino-3,5-dichlorophenyl)-3-ethylthiourea (PubChem CID 8625286) has the molecular formula C9H11Cl2N3S and a molecular weight of 264.18 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-3-ethylthiourea.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-3-ethylthiourea |
|---|---|
| PubChem CID | 8625286 |
| Molecular Formula | C9H11Cl2N3S |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C9H11Cl2N3S/c1-2-13-9(15)14-5-3-6(10)8(12)7(11)4-5/h3-4H,2,12H2,1H3,(H2,13,14,15) |
| InChIKey | WUAQPVDSNKESNT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|