C12H15Cl2N3O2S — CID 9053925
methyl 4-[(4-amino-3,5-dichlorophenyl)carbamothioylamino]butanoate (PubChem CID 9053925) has the molecular formula C12H15Cl2N3O2S and a molecular weight of 336.24 g/mol. Its IUPAC name is methyl 4-[(4-amino-3,5-dichlorophenyl)carbamothioylamino]butanoate.
| Compound Name | methyl 4-[(4-amino-3,5-dichlorophenyl)carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 9053925 |
| Molecular Formula | C12H15Cl2N3O2S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | methyl 4-[(4-amino-3,5-dichlorophenyl)carbamothioylamino]butanoate |
| SMILES | COC(=O)CCCNC(=S)Nc1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3O2S/c1-19-10(18)3-2-4-16-12(20)17-7-5-8(13)11(15)9(14)6-7/h5-6H,2-4,15H2,1H3,(H2,16,17,20) |
| InChIKey | IYLYLPYKYUXHMC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|