C14H18Cl2N2O2S — CID 3282631
ethyl 4-[(3,4-dichlorophenyl)methylcarbamothioylamino]butanoate (PubChem CID 3282631) has the molecular formula C14H18Cl2N2O2S and a molecular weight of 349.28 g/mol. Its IUPAC name is ethyl 4-[(3,4-dichlorophenyl)methylcarbamothioylamino]butanoate.
| Compound Name | ethyl 4-[(3,4-dichlorophenyl)methylcarbamothioylamino]butanoate |
|---|---|
| PubChem CID | 3282631 |
| Molecular Formula | C14H18Cl2N2O2S |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | ethyl 4-[(3,4-dichlorophenyl)methylcarbamothioylamino]butanoate |
| SMILES | CCOC(=O)CCCNC(=S)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O2S/c1-2-20-13(19)4-3-7-17-14(21)18-9-10-5-6-11(15)12(16)8-10/h5-6,8H,2-4,7,9H2,1H3,(H2,17,18,21) |
| InChIKey | YRWYNZSARDAYHO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|