C13H14Cl2O3 — CID 63901312
ethyl 5-(3,4-dichlorophenyl)-4-oxopentanoate (PubChem CID 63901312) has the molecular formula C13H14Cl2O3 and a molecular weight of 289.16 g/mol. Its IUPAC name is ethyl 5-(3,4-dichlorophenyl)-4-oxopentanoate.
| Compound Name | ethyl 5-(3,4-dichlorophenyl)-4-oxopentanoate |
|---|---|
| PubChem CID | 63901312 |
| Molecular Formula | C13H14Cl2O3 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | ethyl 5-(3,4-dichlorophenyl)-4-oxopentanoate |
| SMILES | CCOC(=O)CCC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2O3/c1-2-18-13(17)6-4-10(16)7-9-3-5-11(14)12(15)8-9/h3,5,8H,2,4,6-7H2,1H3 |
| InChIKey | QDPNXGDXRHTNCY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |