C15H19Cl2N3OS — CID 74227780
1-[(3,4-dichlorophenyl)methyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]thiourea (PubChem CID 74227780) has the molecular formula C15H19Cl2N3OS and a molecular weight of 360.31 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]thiourea.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 74227780 |
| Molecular Formula | C15H19Cl2N3OS |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]thiourea |
| SMILES | O=C1CCCN1CCCNC(=S)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2N3OS/c16-12-5-4-11(9-13(12)17)10-19-15(22)18-6-2-8-20-7-1-3-14(20)21/h4-5,9H,1-3,6-8,10H2,(H2,18,19,22) |
| InChIKey | WLZVUIHYUVULFP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|