C13H19N3O2S — CID 2211945
1-(furan-2-ylmethyl)-3-[3-(2-oxopyrrolidin-1-yl)propyl]thiourea (PubChem CID 2211945) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[3-(2-oxopyrrolidin-1-yl)propyl]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[3-(2-oxopyrrolidin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 2211945 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[3-(2-oxopyrrolidin-1-yl)propyl]thiourea |
| SMILES | O=C1CCCN1CCCNC(=S)NCc1ccco1 |
| InChI | InChI=1S/C13H19N3O2S/c17-12-5-1-7-16(12)8-3-6-14-13(19)15-10-11-4-2-9-18-11/h2,4,9H,1,3,5-8,10H2,(H2,14,15,19) |
| InChIKey | JBZFQMOSUQHCKM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|