C17H30N2OS — CID 19651324
1-(furan-2-ylmethyl)-3-undecylthiourea (PubChem CID 19651324) has the molecular formula C17H30N2OS and a molecular weight of 310.51 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-undecylthiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-undecylthiourea |
|---|---|
| PubChem CID | 19651324 |
| Molecular Formula | C17H30N2OS |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-undecylthiourea |
| SMILES | CCCCCCCCCCCNC(=S)NCc1ccco1 |
| InChI | InChI=1S/C17H30N2OS/c1-2-3-4-5-6-7-8-9-10-13-18-17(21)19-15-16-12-11-14-20-16/h11-12,14H,2-10,13,15H2,1H3,(H2,18,19,21) |
| InChIKey | ZAFNZHMWRFBLFJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|