C15H22N2O3 — CID 109134849
1-N-(furan-2-ylmethyl)-2-N-pentylcyclopropane-1,2-dicarboxamide (PubChem CID 109134849) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-N-(furan-2-ylmethyl)-2-N-pentylcyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(furan-2-ylmethyl)-2-N-pentylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109134849 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-N-(furan-2-ylmethyl)-2-N-pentylcyclopropane-1,2-dicarboxamide |
| SMILES | CCCCCNC(=O)C1CC1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H22N2O3/c1-2-3-4-7-16-14(18)12-9-13(12)15(19)17-10-11-6-5-8-20-11/h5-6,8,12-13H,2-4,7,9-10H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | HWTAVKVXCLRPED-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|