C18H32N2OS — CID 19651410
1-dodecyl-3-(furan-2-ylmethyl)thiourea (PubChem CID 19651410) has the molecular formula C18H32N2OS and a molecular weight of 324.53 g/mol. Its IUPAC name is 1-dodecyl-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-dodecyl-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 19651410 |
| Molecular Formula | C18H32N2OS |
| Molecular Weight | 324.53 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 1-dodecyl-3-(furan-2-ylmethyl)thiourea |
| SMILES | CCCCCCCCCCCCNC(=S)NCc1ccco1 |
| InChI | InChI=1S/C18H32N2OS/c1-2-3-4-5-6-7-8-9-10-11-14-19-18(22)20-16-17-13-12-15-21-17/h12-13,15H,2-11,14,16H2,1H3,(H2,19,20,22) |
| InChIKey | XRWSXCRBQIZYHT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|