C19H32N2S — CID 19651318
1-benzyl-3-undecylthiourea (PubChem CID 19651318) has the molecular formula C19H32N2S and a molecular weight of 320.55 g/mol. Its IUPAC name is 1-benzyl-3-undecylthiourea.
| Compound Name | 1-benzyl-3-undecylthiourea |
|---|---|
| PubChem CID | 19651318 |
| Molecular Formula | C19H32N2S |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 1-benzyl-3-undecylthiourea |
| SMILES | CCCCCCCCCCCNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C19H32N2S/c1-2-3-4-5-6-7-8-9-13-16-20-19(22)21-17-18-14-11-10-12-15-18/h10-12,14-15H,2-9,13,16-17H2,1H3,(H2,20,21,22) |
| InChIKey | QAEJCRMWQVPKQB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|