C18H30N2OS — CID 142665779
1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3-octylthiourea (PubChem CID 142665779) has the molecular formula C18H30N2OS and a molecular weight of 322.52 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3-octylthiourea.
| Compound Name | 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3-octylthiourea |
|---|---|
| PubChem CID | 142665779 |
| Molecular Formula | C18H30N2OS |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3-octylthiourea |
| SMILES | CCCCCCCCNC(=S)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C18H30N2OS/c1-2-3-4-5-6-10-13-19-18(22)20-17(15-21)14-16-11-8-7-9-12-16/h7-9,11-12,17,21H,2-6,10,13-15H2,1H3,(H2,19,20,22)/t17-/m1/s1 |
| InChIKey | SGFXMWWLQNXPPZ-QGZVFWFLSA-N |
| XLogP | 3.41 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|